CAS No: 80657-64-3, Chemical Name: A mixture of: ethyl exo-tricyclo[5.2.1.0-{2,6}-]decane-endo-2-carboxylate and ethyl-endo-tricyclo[5.2.1.0-{2,6}-]decane-exo-2-carboxylate
the physical and chemical property of 80657-64-3, A mixture of: ethyl exo-tricyclo[5.2.1.0-{2,6}-]decane-endo-2-carboxylate and ethyl-endo-tricyclo[5.2.1.0-{2,6}-]decane-exo-2-carboxylate is provided by ChemNet.com
ChemNet > CAS > 80657-64-3 A mixture of: ethyl exo-tricyclo[5.2.1.0-{2,6}-]decane-endo-2-carboxylate and ethyl-endo-tricyclo[5.2.1.0-{2,6}-]decane-exo-2-carboxylate
80657-64-3 A mixture of: ethyl exo-tricyclo[5.2.1.0-{2,6}-]decane-endo-2-carboxylate and ethyl-endo-tricyclo[5.2.1.0-{2,6}-]decane-exo-2-carboxylate
| 상품명칭 |
A mixture of: ethyl exo-tricyclo[5.2.1.0-{2,6}-]decane-endo-2-carboxylate and ethyl-endo-tricyclo[5.2.1.0-{2,6}-]decane-exo-2-carboxylate |
| 별명 |
4,7-Methano-3aH-indene-3a-carboxylic acid, octahydro-, ethyl ester, (3aalpha,4alpha,7alpha,7aalpha)-; Ethyl hexahydro-4,7-methanoindane-3a-carboxylate; ethyl (3aR,4S,7R,7aR)-octahydro-3aH-4,7-methanoindene-3a-carboxylate |
| 분자식 |
C13H20O2 |
| 분자량 |
208.2967 |
| InChI |
InChI=1/C13H20O2/c1-2-15-12(14)13-7-3-4-11(13)9-5-6-10(13)8-9/h9-11H,2-8H2,1H3/t9-,10+,11-,13-/m1/s1 |
| cas번호 |
80657-64-3 |
| EC번호 |
407-520-0 |
| 분자 구조 |
![80657-64-3 A mixture of: ethyl exo-tricyclo[5.2.1.0-{2,6}-]decane-endo-2-carboxylate and ethyl-endo-tricyclo[5.2.1.0-{2,6}-]decane-exo-2-carboxylate](https://images-a.chemnet.com/suppliers/chembase/cas6/cas80657-64-3.gif)
|
| 밀도 |
1.106g/cm3 |
| 비등점 |
261.8°C at 760 mmHg |
| 굴절 지수 |
1.524 |
| 인화점 |
109.9°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
|
|
